About 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid
4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid (PubChem CID 145433371) has the molecular formula C10H11ClF3N3O2
and a molecular weight of 297.66 g/mol. Its IUPAC name is 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid.
Molecular Properties
| Compound Name | 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid |
| PubChem CID | 145433371 |
| Molecular Formula | C10H11ClF3N3O2 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid |
| SMILES | FC(F)(F)c1nc(Cl)cc(N2CCCC2)n1.O=CO |
| InChI | InChI=1S/C9H9ClF3N3.CH2O2/c10-6-5-7(16-3-1-2-4-16)15-8(14-6)9(11,12)13;2-1-3/h5H,1-4H2;1H,(H,2,3) |
| InChIKey | VGBKOCFEVAXELB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid?
The IUPAC name of 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid (CID 145433371) is 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid.
What is the SMILES notation for 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid?
The canonical SMILES for 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid is FC(F)(F)c1nc(Cl)cc(N2CCCC2)n1.O=CO.
What is the InChIKey of 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid?
The InChIKey is VGBKOCFEVAXELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF3N3.CH2O2/c10-6-5-7(16-3-1-2-4-16)15-8(14-6)9(11,12)13;2-1-3/h5H,1-4H2;1H,(H,2,3).
What are the key properties of 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid?
4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid has a molecular weight of 297.66 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidine;formic acid is sourced from PubChem (CID 145433371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).