C24H25F3N6O2 — CID 145433414
N-[2-(4-cyanophenyl)ethyl]formamide;3,5-dimethyl-4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,2-oxazole (PubChem CID 145433414) has the molecular formula C24H25F3N6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[2-(4-cyanophenyl)ethyl]formamide;3,5-dimethyl-4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,2-oxazole.
| Compound Name | N-[2-(4-cyanophenyl)ethyl]formamide;3,5-dimethyl-4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 145433414 |
| Molecular Formula | C24H25F3N6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | N-[2-(4-cyanophenyl)ethyl]formamide;3,5-dimethyl-4-[6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cc(N2CCCC2)nc(C(F)(F)F)n1.N#Cc1ccc(CCNC=O)cc1 |
| InChI | InChI=1S/C14H15F3N4O.C10H10N2O/c1-8-12(9(2)22-20-8)10-7-11(21-5-3-4-6-21)19-13(18-10)14(15,16)17;11-7-10-3-1-9(2-4-10)5-6-12-8-13/h7H,3-6H2,1-2H3;1-4,8H,5-6H2,(H,12,13) |
| InChIKey | AXVNQDBLVWXCEO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|