C13H15NO3 — CID 14543427
2-[(2R)-1-[(4-methoxyphenyl)methyl]-4-oxoazetidin-2-yl]acetaldehyde (PubChem CID 14543427) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[(2R)-1-[(4-methoxyphenyl)methyl]-4-oxoazetidin-2-yl]acetaldehyde.
| Compound Name | 2-[(2R)-1-[(4-methoxyphenyl)methyl]-4-oxoazetidin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 14543427 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-[(2R)-1-[(4-methoxyphenyl)methyl]-4-oxoazetidin-2-yl]acetaldehyde |
| SMILES | COc1ccc(CN2C(=O)C[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-17-12-4-2-10(3-5-12)9-14-11(6-7-15)8-13(14)16/h2-5,7,11H,6,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | VKOXTKIQSCDPNI-LLVKDONJSA-N |
| XLogP | 1.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|