C16H22O10 — CID 14543431
(3S,4S,4aS)-4-[(2S)-oxiran-2-yl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-8-one (PubChem CID 14543431) has the molecular formula C16H22O10 and a molecular weight of 374.34 g/mol. Its IUPAC name is (3S,4S,4aS)-4-[(2S)-oxiran-2-yl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-8-one.
| Compound Name | (3S,4S,4aS)-4-[(2S)-oxiran-2-yl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-8-one |
|---|---|
| PubChem CID | 14543431 |
| Molecular Formula | C16H22O10 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (3S,4S,4aS)-4-[(2S)-oxiran-2-yl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-8-one |
| SMILES | O=C1OCC[C@@H]2C1=CO[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@H]2[C@H]1CO1 |
| InChI | InChI=1S/C16H22O10/c17-3-8-11(18)12(19)13(20)16(25-8)26-15-10(9-5-23-9)6-1-2-22-14(21)7(6)4-24-15/h4,6,8-13,15-20H,1-3,5H2/t6-,8-,9-,10+,11-,12+,13-,15+,16+/m1/s1 |
| InChIKey | OTGGZHYFDGWERE-NRLQVXEQSA-N |
| XLogP | -2.38 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|