C39H56O2 — CID 14543441
[(3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 14543441) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is [(3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 14543441 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | [(3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC[C@]2(C)C3=C(CC[C@@]12C)[C@@]1(C)CC[C@H](OC(=O)/C=C/c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C39H56O2/c1-27(2)13-12-14-28(3)30-21-25-39(8)32-18-19-33-36(4,5)34(41-35(40)20-17-29-15-10-9-11-16-29)23-24-37(33,6)31(32)22-26-38(30,39)7/h9-11,13,15-17,20,28,30,33-34H,12,14,18-19,21-26H2,1-8H3/b20-17+/t28-,30+,33+,34+,37-,38+,39-/m1/s1 |
| InChIKey | YNUAVCIRODJHRP-AKWMTVAUSA-N |
| XLogP | 10.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|