C20H20F2N6O3 — CID 145434653
(5R,11R)-N-(3-cyano-4-fluorophenyl)-11-(fluoromethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434653) has the molecular formula C20H20F2N6O3 and a molecular weight of 430.42 g/mol. Its IUPAC name is (5R,11R)-N-(3-cyano-4-fluorophenyl)-11-(fluoromethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-N-(3-cyano-4-fluorophenyl)-11-(fluoromethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434653 |
| Molecular Formula | C20H20F2N6O3 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (5R,11R)-N-(3-cyano-4-fluorophenyl)-11-(fluoromethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(C#N)c1)C(=O)N(C)O[C@@H](CF)C3 |
| InChI | InChI=1S/C20H20F2N6O3/c1-11-5-17-15(18-19(29)26(2)31-14(7-21)9-28(18)25-17)10-27(11)20(30)24-13-3-4-16(22)12(6-13)8-23/h3-4,6,11,14H,5,7,9-10H2,1-2H3,(H,24,30)/t11-,14+/m1/s1 |
| InChIKey | UEQSQEBFCCYEFD-RISCZKNCSA-N |
| XLogP | 2.23 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |