C21H25ClF2N6O3 — CID 145434747
N-(5-chloro-2,4-difluorophenyl)-11-[(dimethylamino)methyl]-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434747) has the molecular formula C21H25ClF2N6O3 and a molecular weight of 482.92 g/mol. Its IUPAC name is N-(5-chloro-2,4-difluorophenyl)-11-[(dimethylamino)methyl]-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(5-chloro-2,4-difluorophenyl)-11-[(dimethylamino)methyl]-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434747 |
| Molecular Formula | C21H25ClF2N6O3 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-(5-chloro-2,4-difluorophenyl)-11-[(dimethylamino)methyl]-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CC1Cc2nn3c(c2CN1C(=O)Nc1cc(Cl)c(F)cc1F)C(=O)N(C)OC(CN(C)C)C3 |
| InChI | InChI=1S/C21H25ClF2N6O3/c1-11-5-17-13(10-29(11)21(32)25-18-6-14(22)15(23)7-16(18)24)19-20(31)28(4)33-12(8-27(2)3)9-30(19)26-17/h6-7,11-12H,5,8-10H2,1-4H3,(H,25,32) |
| InChIKey | RMPWMEVTLSIGQU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|