C20H22ClFN6O4 — CID 145434818
4-N-(3-chloro-4-fluorophenyl)-11-N,11-N,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide (PubChem CID 145434818) has the molecular formula C20H22ClFN6O4 and a molecular weight of 464.89 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-11-N,11-N,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-11-N,11-N,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide |
|---|---|
| PubChem CID | 145434818 |
| Molecular Formula | C20H22ClFN6O4 |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-11-N,11-N,13-trimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxamide |
| SMILES | CN(C)C(=O)C1Cn2nc3c(c2C(=O)N(C)O1)CN(C(=O)Nc1ccc(F)c(Cl)c1)CC3 |
| InChI | InChI=1S/C20H22ClFN6O4/c1-25(2)18(29)16-10-28-17(19(30)26(3)32-16)12-9-27(7-6-15(12)24-28)20(31)23-11-4-5-14(22)13(21)8-11/h4-5,8,16H,6-7,9-10H2,1-3H3,(H,23,31) |
| InChIKey | PTQIIKZVLRKACD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |