C22H24F3N7O2 — CID 145434892
N-(3-cyano-4-fluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145434892) has the molecular formula C22H24F3N7O2 and a molecular weight of 475.48 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145434892 |
| Molecular Formula | C22H24F3N7O2 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-11-[(2,2-difluoroethylamino)methyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CN1CC(CNCC(F)F)Cn2nc3c(c2C1=O)CN(C(=O)Nc1ccc(F)c(C#N)c1)CC3 |
| InChI | InChI=1S/C22H24F3N7O2/c1-30-10-13(8-27-9-19(24)25)11-32-20(21(30)33)16-12-31(5-4-18(16)29-32)22(34)28-15-2-3-17(23)14(6-15)7-26/h2-3,6,13,19,27H,4-5,8-12H2,1H3,(H,28,34) |
| InChIKey | JVTNRRRDBBFCAY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |