C22H23F3N6O3 — CID 145435003
N-(3-cyano-4-fluorophenyl)-5-(2,2-difluoroethoxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide (PubChem CID 145435003) has the molecular formula C22H23F3N6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-5-(2,2-difluoroethoxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-5-(2,2-difluoroethoxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide |
|---|---|
| PubChem CID | 145435003 |
| Molecular Formula | C22H23F3N6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-5-(2,2-difluoroethoxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide |
| SMILES | CC1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(C#N)c1)C(=O)N(C)C(COCC(F)F)C3 |
| InChI | InChI=1S/C22H23F3N6O3/c1-12-5-18-16(9-30(12)22(33)27-14-3-4-17(23)13(6-14)7-26)20-21(32)29(2)15(8-31(20)28-18)10-34-11-19(24)25/h3-4,6,12,15,19H,5,8-11H2,1-2H3,(H,27,33) |
| InChIKey | OKTKZPAURFKDKO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |