C19H21ClFN5O3 — CID 145435023
N-(3-chloro-4-fluorophenyl)-11-(hydroxymethyl)-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 145435023) has the molecular formula C19H21ClFN5O3 and a molecular weight of 421.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-11-(hydroxymethyl)-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-11-(hydroxymethyl)-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 145435023 |
| Molecular Formula | C19H21ClFN5O3 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-11-(hydroxymethyl)-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CN1CC(CO)Cn2nc3c(c2C1=O)CN(C(=O)Nc1ccc(F)c(Cl)c1)CC3 |
| InChI | InChI=1S/C19H21ClFN5O3/c1-24-7-11(10-27)8-26-17(18(24)28)13-9-25(5-4-16(13)23-26)19(29)22-12-2-3-15(21)14(20)6-12/h2-3,6,11,27H,4-5,7-10H2,1H3,(H,22,29) |
| InChIKey | HMQZBRIXVQIBLQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |