C17H30F3NO6S — CID 145435223
[4-[(7R)-2-(aminomethyl)-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-7-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate;ethane (PubChem CID 145435223) has the molecular formula C17H30F3NO6S and a molecular weight of 433.49 g/mol. Its IUPAC name is [4-[(7R)-2-(aminomethyl)-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-7-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate;ethane.
| Compound Name | [4-[(7R)-2-(aminomethyl)-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-7-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate;ethane |
|---|---|
| PubChem CID | 145435223 |
| Molecular Formula | C17H30F3NO6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [4-[(7R)-2-(aminomethyl)-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-7-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate;ethane |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)C(C)C[C@H]1CCC2OC(CN)COCC2O1.CC |
| InChI | InChI=1S/C15H24F3NO6S.C2H6/c1-9(10(2)25-26(20,21)15(16,17)18)5-11-3-4-13-14(23-11)8-22-7-12(6-19)24-13;1-2/h9,11-14H,2-8,19H2,1H3;1-2H3/t9?,11-,12?,13?,14?;/m1./s1 |
| InChIKey | CNRWVLGCNULBRE-PUWXAZPWSA-N |
| XLogP | 2.71 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|