C30H53N5O12 — CID 145435576
4-[2-[[2-[ethyl-[4-oxo-4-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethylamino]butanoyl]amino]acetyl]amino]hexanoylamino]piperidine-4-carboxylic acid (PubChem CID 145435576) has the molecular formula C30H53N5O12 and a molecular weight of 675.78 g/mol. Its IUPAC name is 4-[2-[[2-[ethyl-[4-oxo-4-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethylamino]butanoyl]amino]acetyl]amino]hexanoylamino]piperidine-4-carboxylic acid.
| Compound Name | 4-[2-[[2-[ethyl-[4-oxo-4-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethylamino]butanoyl]amino]acetyl]amino]hexanoylamino]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 145435576 |
| Molecular Formula | C30H53N5O12 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.37 |
| IUPAC Name | 4-[2-[[2-[ethyl-[4-oxo-4-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethylamino]butanoyl]amino]acetyl]amino]hexanoylamino]piperidine-4-carboxylic acid |
| SMILES | CCCCC(NC(=O)CN(CC)C(=O)CCC(=O)NCCOCCO[C@@H]1OC(C)[C@H](O)C(O)C1O)C(=O)NC1(C(=O)O)CCNCC1 |
| InChI | InChI=1S/C30H53N5O12/c1-4-6-7-20(27(42)34-30(29(43)44)10-12-31-13-11-30)33-22(37)18-35(5-2)23(38)9-8-21(36)32-14-15-45-16-17-46-28-26(41)25(40)24(39)19(3)47-28/h19-20,24-26,28,31,39-41H,4-18H2,1-3H3,(H,32,36)(H,33,37)(H,34,42)(H,43,44)/t19?,20?,24-,25?,26?,28+/m0/s1 |
| InChIKey | CHJPFLRWRVOGTG-VYBQZKAUSA-N |
| XLogP | -2.41 |
| TPSA | 245.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|