C29H36O5 — CID 145435922
3-hydroxy-4,6b,8a,11,14-pentamethyl-6a,7,8,9,10,11,12,12a-octahydropicene-2,13-dione;methyl formate (PubChem CID 145435922) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 3-hydroxy-4,6b,8a,11,14-pentamethyl-6a,7,8,9,10,11,12,12a-octahydropicene-2,13-dione;methyl formate.
| Compound Name | 3-hydroxy-4,6b,8a,11,14-pentamethyl-6a,7,8,9,10,11,12,12a-octahydropicene-2,13-dione;methyl formate |
|---|---|
| PubChem CID | 145435922 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 3-hydroxy-4,6b,8a,11,14-pentamethyl-6a,7,8,9,10,11,12,12a-octahydropicene-2,13-dione;methyl formate |
| SMILES | CC1=C(O)C(=O)C=c2c1ccc1c2=C(C)C(=O)C2C3CC(C)CCC3(C)CCC12C.COC=O |
| InChI | InChI=1S/C27H32O3.C2H4O2/c1-14-8-9-26(4)10-11-27(5)19-7-6-17-15(2)24(29)21(28)13-18(17)22(19)16(3)25(30)23(27)20(26)12-14;1-4-2-3/h6-7,13-14,20,23,29H,8-12H2,1-5H3;2H,1H3 |
| InChIKey | KEDHQOLLCIRSMH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|