C37H46ClNO2 — CID 145435950
3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-6-chloro-1H-indole;formic acid (PubChem CID 145435950) has the molecular formula C37H46ClNO2 and a molecular weight of 572.23 g/mol. Its IUPAC name is 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-6-chloro-1H-indole;formic acid.
| Compound Name | 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-6-chloro-1H-indole;formic acid |
|---|---|
| PubChem CID | 145435950 |
| Molecular Formula | C37H46ClNO2 |
| Molecular Weight | 572.23 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-6-chloro-1H-indole;formic acid |
| SMILES | Cc1cccc2c1C(c1c[nH]c3cc(Cl)ccc13)C=C1C2(C)CC[C@@]2(C)C3CC(C)CCC3(C)CCC12C.O=CO |
| InChI | InChI=1S/C36H44ClN.CH2O2/c1-22-12-13-33(3)14-16-36(6)31-20-26(27-21-38-29-19-24(37)10-11-25(27)29)32-23(2)8-7-9-28(32)34(31,4)15-17-35(36,5)30(33)18-22;2-1-3/h7-11,19-22,26,30,38H,12-18H2,1-6H3;1H,(H,2,3)/t22?,26?,30?,33?,34?,35-,36?;/m0./s1 |
| InChIKey | GZHNYQRVNZXSAD-FEHIAKKWSA-N |
| XLogP | 10.20 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.23 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|