C36H44ClN — CID 145435980
3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-5-chloro-1H-indole (PubChem CID 145435980) has the molecular formula C36H44ClN and a molecular weight of 526.21 g/mol. Its IUPAC name is 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-5-chloro-1H-indole.
| Compound Name | 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-5-chloro-1H-indole |
|---|---|
| PubChem CID | 145435980 |
| Molecular Formula | C36H44ClN |
| Molecular Weight | 526.21 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 3-[(6aS)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-5-yl]-5-chloro-1H-indole |
| SMILES | Cc1cccc2c1C(c1c[nH]c3ccc(Cl)cc13)C=C1C2(C)CC[C@@]2(C)C3CC(C)CCC3(C)CCC12C |
| InChI | InChI=1S/C36H44ClN/c1-22-12-13-33(3)14-16-36(6)31-20-26(27-21-38-29-11-10-24(37)19-25(27)29)32-23(2)8-7-9-28(32)34(31,4)15-17-35(36,5)30(33)18-22/h7-11,19-22,26,30,38H,12-18H2,1-6H3/t22?,26?,30?,33?,34?,35-,36?/m0/s1 |
| InChIKey | MZIGYWDMKKFIDS-WUORYJQKSA-N |
| XLogP | 10.50 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.21 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|