About 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine
2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 145436390) has the molecular formula C9H10FN3
and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 145436390 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CC(C)c1cnc2cc(F)nn2c1 |
| InChI | InChI=1S/C9H10FN3/c1-6(2)7-4-11-9-3-8(10)12-13(9)5-7/h3-6H,1-2H3 |
| InChIKey | FDSSIQLAFPLALH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine (CID 145436390) is 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine is CC(C)c1cnc2cc(F)nn2c1.
What is the InChIKey of 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine?
The InChIKey is FDSSIQLAFPLALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3/c1-6(2)7-4-11-9-3-8(10)12-13(9)5-7/h3-6H,1-2H3.
What are the key properties of 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine?
2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine has a molecular weight of 179.20 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-propan-2-ylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 145436390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).