C9H5N3O3S — CID 145436768
2-(furan-2-yl)-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (PubChem CID 145436768) has the molecular formula C9H5N3O3S and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-(furan-2-yl)-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
| Compound Name | 2-(furan-2-yl)-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 145436768 |
| Molecular Formula | C9H5N3O3S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 2-(furan-2-yl)-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| SMILES | O=c1[nH]c(=O)c2nc(-c3ccco3)sc2[nH]1 |
| InChI | InChI=1S/C9H5N3O3S/c13-6-5-8(12-9(14)11-6)16-7(10-5)4-2-1-3-15-4/h1-3H,(H2,11,12,13,14) |
| InChIKey | GCZSUHJKIOTHTD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |