C21H23N5O3 — CID 145436791
5-benzyl-N-[(2S)-1-[2-(dimethylamino)phenoxy]-3-oxopropan-2-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 145436791) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 5-benzyl-N-[(2S)-1-[2-(dimethylamino)phenoxy]-3-oxopropan-2-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(2S)-1-[2-(dimethylamino)phenoxy]-3-oxopropan-2-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 145436791 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 5-benzyl-N-[(2S)-1-[2-(dimethylamino)phenoxy]-3-oxopropan-2-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C)c1ccccc1OC[C@@H](C=O)NC(=O)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H23N5O3/c1-26(2)17-10-6-7-11-18(17)29-14-16(13-27)22-21(28)20-23-19(24-25-20)12-15-8-4-3-5-9-15/h3-11,13,16H,12,14H2,1-2H3,(H,22,28)(H,23,24,25)/t16-/m1/s1 |
| InChIKey | PLSNSBWZTYWPJG-MRXNPFEDSA-N |
| XLogP | 1.84 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|