C29H35N3O5 — CID 145437001
(6E,8E)-8-cyano-6-[[6-(cyclopropylmethylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]undeca-6,8-dienoic acid (PubChem CID 145437001) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is (6E,8E)-8-cyano-6-[[6-(cyclopropylmethylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]undeca-6,8-dienoic acid.
| Compound Name | (6E,8E)-8-cyano-6-[[6-(cyclopropylmethylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]undeca-6,8-dienoic acid |
|---|---|
| PubChem CID | 145437001 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (6E,8E)-8-cyano-6-[[6-(cyclopropylmethylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]undeca-6,8-dienoic acid |
| SMILES | CC/C=C(C#N)\C=C(/CCCCC(=O)O)NC(=O)C1CC12CCOc1ccc(C(=O)NCC3CC3)cc12 |
| InChI | InChI=1S/C29H35N3O5/c1-2-5-20(17-30)14-22(6-3-4-7-26(33)34)32-28(36)24-16-29(24)12-13-37-25-11-10-21(15-23(25)29)27(35)31-18-19-8-9-19/h5,10-11,14-15,19,24H,2-4,6-9,12-13,16,18H2,1H3,(H,31,35)(H,32,36)(H,33,34)/b20-5+,22-14+ |
| InChIKey | WAKIJLFZJQPLDY-IBSYGTPMSA-N |
| XLogP | 4.37 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|