C20H30O4 — CID 14543725
(E)-5-[(1R,2S,4R,4aR,8aR)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoic acid (PubChem CID 14543725) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (E)-5-[(1R,2S,4R,4aR,8aR)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoic acid.
| Compound Name | (E)-5-[(1R,2S,4R,4aR,8aR)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 14543725 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (E)-5-[(1R,2S,4R,4aR,8aR)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoic acid |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CC/C(C)=C/C(=O)O)[C@H](C)C(=O)[C@H](O)[C@@]12C |
| InChI | InChI=1S/C20H30O4/c1-12(11-16(21)22)9-10-19(4)14(3)17(23)18(24)20(5)13(2)7-6-8-15(19)20/h7,11,14-15,18,24H,6,8-10H2,1-5H3,(H,21,22)/b12-11+/t14-,15-,18+,19+,20+/m1/s1 |
| InChIKey | QBTMVLQTZBMTNE-WBJSIRLMSA-N |
| XLogP | 3.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|