C16H21NO3 — CID 145437466
12-oxo-3-oxa-11-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-10-carbaldehyde (PubChem CID 145437466) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 12-oxo-3-oxa-11-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-10-carbaldehyde.
| Compound Name | 12-oxo-3-oxa-11-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-10-carbaldehyde |
|---|---|
| PubChem CID | 145437466 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 12-oxo-3-oxa-11-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-10-carbaldehyde |
| SMILES | O=CC1CCCCCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C16H21NO3/c18-11-14-8-3-1-2-6-10-20-12-13-7-4-5-9-15(13)16(19)17-14/h4-5,7,9,11,14H,1-3,6,8,10,12H2,(H,17,19) |
| InChIKey | VGUDAODQEPQUPO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|