C17H23NO4 — CID 145437511
(6Z,12Z)-7-ethenyl-8-oxo-6-[(Z)-prop-1-enyl]-1,4-dioxa-9-azacyclotetradeca-6,12-diene-10-carbaldehyde (PubChem CID 145437511) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (6Z,12Z)-7-ethenyl-8-oxo-6-[(Z)-prop-1-enyl]-1,4-dioxa-9-azacyclotetradeca-6,12-diene-10-carbaldehyde.
| Compound Name | (6Z,12Z)-7-ethenyl-8-oxo-6-[(Z)-prop-1-enyl]-1,4-dioxa-9-azacyclotetradeca-6,12-diene-10-carbaldehyde |
|---|---|
| PubChem CID | 145437511 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (6Z,12Z)-7-ethenyl-8-oxo-6-[(Z)-prop-1-enyl]-1,4-dioxa-9-azacyclotetradeca-6,12-diene-10-carbaldehyde |
| SMILES | C=C/C1=C(\C=C/C)COCCOC/C=C\CC(C=O)NC1=O |
| InChI | InChI=1S/C17H23NO4/c1-3-7-14-13-22-11-10-21-9-6-5-8-15(12-19)18-17(20)16(14)4-2/h3-7,12,15H,2,8-11,13H2,1H3,(H,18,20)/b6-5-,7-3-,16-14- |
| InChIKey | KECCGHLLDLUVAU-DXKWJNNBSA-N |
| XLogP | 1.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|