C18H23NO6 — CID 145437829
methyl 2-oxo-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetate (PubChem CID 145437829) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is methyl 2-oxo-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetate.
| Compound Name | methyl 2-oxo-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetate |
|---|---|
| PubChem CID | 145437829 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 2-oxo-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetate |
| SMILES | COC(=O)C(=O)C1CCCCOCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C18H23NO6/c1-23-18(22)16(20)15-8-4-5-9-24-10-11-25-12-13-6-2-3-7-14(13)17(21)19-15/h2-3,6-7,15H,4-5,8-12H2,1H3,(H,19,21) |
| InChIKey | DCHCIROWSJTQMD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|