C22H24N2O4 — CID 145437919
(15E)-N-methoxy-N-methyl-5-oxo-13-oxa-4-azatricyclo[15.3.1.06,11]henicosa-1(21),6,8,10,15,17,19-heptaene-3-carboxamide (PubChem CID 145437919) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (15E)-N-methoxy-N-methyl-5-oxo-13-oxa-4-azatricyclo[15.3.1.06,11]henicosa-1(21),6,8,10,15,17,19-heptaene-3-carboxamide.
| Compound Name | (15E)-N-methoxy-N-methyl-5-oxo-13-oxa-4-azatricyclo[15.3.1.06,11]henicosa-1(21),6,8,10,15,17,19-heptaene-3-carboxamide |
|---|---|
| PubChem CID | 145437919 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (15E)-N-methoxy-N-methyl-5-oxo-13-oxa-4-azatricyclo[15.3.1.06,11]henicosa-1(21),6,8,10,15,17,19-heptaene-3-carboxamide |
| SMILES | CON(C)C(=O)C1Cc2cccc(c2)/C=C\COCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C22H24N2O4/c1-24(27-2)22(26)20-14-17-8-5-7-16(13-17)9-6-12-28-15-18-10-3-4-11-19(18)21(25)23-20/h3-11,13,20H,12,14-15H2,1-2H3,(H,23,25)/b9-6- |
| InChIKey | HHXZVRWPWRXHGD-TWGQIWQCSA-N |
| XLogP | 2.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|