C21H13ClF8N6O2 — CID 145438825
2-[[[6-chloro-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 145438825) has the molecular formula C21H13ClF8N6O2 and a molecular weight of 568.81 g/mol. Its IUPAC name is 2-[[[6-chloro-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[[6-chloro-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 145438825 |
| Molecular Formula | C21H13ClF8N6O2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 2-[[[6-chloro-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CNc1nc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)nc(Cl)c1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H13ClF8N6O2/c22-16-15(24)18(31-9-19(37,20(25,26)27)21(28,29)30)33-17(32-16)13-7-14(12-5-6-38-35-12)36(34-13)8-10-3-1-2-4-11(10)23/h1-7,37H,8-9H2,(H,31,32,33) |
| InChIKey | HZGNUVGOBRNWNS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |