C21H24BN3O3 — CID 145438865
4-benzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one (PubChem CID 145438865) has the molecular formula C21H24BN3O3 and a molecular weight of 377.25 g/mol. Its IUPAC name is 4-benzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 4-benzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 145438865 |
| Molecular Formula | C21H24BN3O3 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-benzyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
| SMILES | CC1(C)OB(c2ccc(-n3ncn(Cc4ccccc4)c3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C21H24BN3O3/c1-20(2)21(3,4)28-22(27-20)17-10-12-18(13-11-17)25-19(26)24(15-23-25)14-16-8-6-5-7-9-16/h5-13,15H,14H2,1-4H3 |
| InChIKey | NZUYSJBHDNGTRG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|