C23H25N3O — CID 145438936
7-[(1Z)-buta-1,3-dienyl]-8-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]-2-azaspiro[4.5]dec-7-en-1-one (PubChem CID 145438936) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-8-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]-2-azaspiro[4.5]dec-7-en-1-one.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-8-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]-2-azaspiro[4.5]dec-7-en-1-one |
|---|---|
| PubChem CID | 145438936 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-8-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]-2-azaspiro[4.5]dec-7-en-1-one |
| SMILES | C=C/C=C\C1=C(C)CCC2(CCN(c3ccc(-c4cn[nH]c4)cc3)C2=O)C1 |
| InChI | InChI=1S/C23H25N3O/c1-3-4-5-19-14-23(11-10-17(19)2)12-13-26(22(23)27)21-8-6-18(7-9-21)20-15-24-25-16-20/h3-9,15-16H,1,10-14H2,2H3,(H,24,25)/b5-4- |
| InChIKey | PFFAVBVEJBIQGP-PLNGDYQASA-N |
| XLogP | 5.04 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|