C21H19ClF3N3OS2 — CID 145439205
6-[5-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-ethylsulfanylspiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 145439205) has the molecular formula C21H19ClF3N3OS2 and a molecular weight of 485.98 g/mol. Its IUPAC name is 6-[5-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-ethylsulfanylspiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-[5-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-ethylsulfanylspiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 145439205 |
| Molecular Formula | C21H19ClF3N3OS2 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 6-[5-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-ethylsulfanylspiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | CCSN1CC2(C1)OCc1cc(C3=NSC(c4ccc(Cl)nc4)(C(F)(F)F)C3)ccc12 |
| InChI | InChI=1S/C21H19ClF3N3OS2/c1-2-30-28-11-19(12-28)16-5-3-13(7-14(16)10-29-19)17-8-20(31-27-17,21(23,24)25)15-4-6-18(22)26-9-15/h3-7,9H,2,8,10-12H2,1H3 |
| InChIKey | MTPNJWGIQLFXQT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|