C20H31NO7 — CID 145439337
(2,5-dioxopyrrolidin-1-yl) 3-[2-(3-cyclooctyl-3-oxopropoxy)ethoxy]propanoate (PubChem CID 145439337) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-(3-cyclooctyl-3-oxopropoxy)ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(3-cyclooctyl-3-oxopropoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 145439337 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(3-cyclooctyl-3-oxopropoxy)ethoxy]propanoate |
| SMILES | O=C(CCOCCOCCC(=O)C1CCCCCCC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H31NO7/c22-17(16-6-4-2-1-3-5-7-16)10-12-26-14-15-27-13-11-20(25)28-21-18(23)8-9-19(21)24/h16H,1-15H2 |
| InChIKey | WYYIZDLEBWGOPL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|