C26H32F2N8 — CID 145440481
acetylene;7-(2,3-difluorophenyl)-4-N,5,5-trimethyl-2-N-[[(6-methylpyrimidin-4-yl)-propan-2-ylamino]methyl]-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 145440481) has the molecular formula C26H32F2N8 and a molecular weight of 494.59 g/mol. Its IUPAC name is acetylene;7-(2,3-difluorophenyl)-4-N,5,5-trimethyl-2-N-[[(6-methylpyrimidin-4-yl)-propan-2-ylamino]methyl]-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | acetylene;7-(2,3-difluorophenyl)-4-N,5,5-trimethyl-2-N-[[(6-methylpyrimidin-4-yl)-propan-2-ylamino]methyl]-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145440481 |
| Molecular Formula | C26H32F2N8 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | acetylene;7-(2,3-difluorophenyl)-4-N,5,5-trimethyl-2-N-[[(6-methylpyrimidin-4-yl)-propan-2-ylamino]methyl]-6H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | C#C.CNc1nc(NCN(c2cc(C)ncn2)C(C)C)nc2c1C(C)(C)CN2c1cccc(F)c1F |
| InChI | InChI=1S/C24H30F2N8.C2H2/c1-14(2)34(18-10-15(3)28-12-29-18)13-30-23-31-21(27-6)19-22(32-23)33(11-24(19,4)5)17-9-7-8-16(25)20(17)26;1-2/h7-10,12,14H,11,13H2,1-6H3,(H2,27,30,31,32);1-2H |
| InChIKey | XXVFPLNENOXFSP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|