C19H18F3NO3S — CID 145440529
[2-cyclohexa-1,5-dien-1-yl-4-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]phenyl] trifluoromethanesulfonate (PubChem CID 145440529) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is [2-cyclohexa-1,5-dien-1-yl-4-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-cyclohexa-1,5-dien-1-yl-4-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145440529 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-cyclohexa-1,5-dien-1-yl-4-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]phenyl] trifluoromethanesulfonate |
| SMILES | C=C/C=C(\N=C\C)c1ccc(OS(=O)(=O)C(F)(F)F)c(C2=CCCC=C2)c1 |
| InChI | InChI=1S/C19H18F3NO3S/c1-3-8-17(23-4-2)15-11-12-18(26-27(24,25)19(20,21)22)16(13-15)14-9-6-5-7-10-14/h3-4,6,8-13H,1,5,7H2,2H3/b17-8-,23-4+ |
| InChIKey | MDPOUYWJCAZDET-WCMDHVGTSA-N |
| XLogP | 5.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|