C26H32N8O3S — CID 145440766
4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]amino]-2-(3-methyl-4-morpholin-4-ylanilino)-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 145440766) has the molecular formula C26H32N8O3S and a molecular weight of 536.66 g/mol. Its IUPAC name is 4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]amino]-2-(3-methyl-4-morpholin-4-ylanilino)-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]amino]-2-(3-methyl-4-morpholin-4-ylanilino)-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145440766 |
| Molecular Formula | C26H32N8O3S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]amino]-2-(3-methyl-4-morpholin-4-ylanilino)-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(N3CCOCC3)c(C)c2)nc1Nc1cccc(N=S(C)(C)=O)n1 |
| InChI | InChI=1S/C26H32N8O3S/c1-5-11-27-25(35)20-17-28-26(29-19-9-10-21(18(2)16-19)34-12-14-37-15-13-34)32-24(20)31-22-7-6-8-23(30-22)33-38(3,4)36/h5-10,16-17H,1,11-15H2,2-4H3,(H,27,35)(H2,28,29,30,31,32) |
| InChIKey | SPAOUQSZIVROQM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|