C12H16F3N3 — CID 145440975
2,4-dimethyl-3-[(E)-5,5,5-trifluoro-4-iminopent-2-enyl]-2,3-dihydropyridin-6-amine (PubChem CID 145440975) has the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2,4-dimethyl-3-[(E)-5,5,5-trifluoro-4-iminopent-2-enyl]-2,3-dihydropyridin-6-amine.
| Compound Name | 2,4-dimethyl-3-[(E)-5,5,5-trifluoro-4-iminopent-2-enyl]-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 145440975 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2,4-dimethyl-3-[(E)-5,5,5-trifluoro-4-iminopent-2-enyl]-2,3-dihydropyridin-6-amine |
| SMILES | [H]/N=C(/C=C/CC1C(C)=CC(N)=NC1C)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3/c1-7-6-11(17)18-8(2)9(7)4-3-5-10(16)12(13,14)15/h3,5-6,8-9,16H,4H2,1-2H3,(H2,17,18)/b5-3+,16-10- |
| InChIKey | QHWDWWLKEFQCJD-PVHCHUPNSA-N |
| XLogP | 2.84 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|