C17H21N7O — CID 145441209
(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 145441209) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 145441209 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | CN1CC2CN(C(=O)c3cnc(NCc4cnccn4)nc3)CC2C1 |
| InChI | InChI=1S/C17H21N7O/c1-23-8-13-10-24(11-14(13)9-23)16(25)12-4-20-17(21-5-12)22-7-15-6-18-2-3-19-15/h2-6,13-14H,7-11H2,1H3,(H,20,21,22) |
| InChIKey | JMAUSYFQFIZXCR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |