About 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene
3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene (PubChem CID 145441469) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene.
Molecular Properties
| Compound Name | 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene |
| PubChem CID | 145441469 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene |
| SMILES | C=CCC(C)(C=C)/N=N/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18N2/c1-4-12-17(3,5-2)19-18-16-11-10-14-8-6-7-9-15(14)13-16/h4-11,13H,1-2,12H2,3H3/b19-18+ |
| InChIKey | XVIGASKIOKHTMS-VHEBQXMUSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene?
The IUPAC name of 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene (CID 145441469) is 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene.
What is the SMILES notation for 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene?
The canonical SMILES for 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene is C=CCC(C)(C=C)/N=N/c1ccc2ccccc2c1.
What is the InChIKey of 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene?
The InChIKey is XVIGASKIOKHTMS-VHEBQXMUSA-N. The full InChI is InChI=1S/C17H18N2/c1-4-12-17(3,5-2)19-18-16-11-10-14-8-6-7-9-15(14)13-16/h4-11,13H,1-2,12H2,3H3/b19-18+.
What are the key properties of 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene?
3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene has a molecular weight of 250.34 g/mol, XLogP of 5.44, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexa-1,5-dien-3-yl(naphthalen-2-yl)diazene is sourced from PubChem (CID 145441469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).