C13H18N2 — CID 145441525
[(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene (PubChem CID 145441525) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene |
|---|---|
| PubChem CID | 145441525 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene |
| SMILES | C/C=C\C(=C/C)\N=N\C1=CC=C(C)CC1 |
| InChI | InChI=1S/C13H18N2/c1-4-6-12(5-2)14-15-13-9-7-11(3)8-10-13/h4-7,9H,8,10H2,1-3H3/b6-4-,12-5+,15-14+ |
| InChIKey | QSUUHIYXBYLFOQ-YGULVFPLSA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|