C59H52N2O9 — CID 145442200
6-[4-[N-naphthalen-1-yl-4-[4-(N-[4-(2,3,5,6-tetrahydroxy-4-methylphenyl)phenyl]anilino)phenyl]anilino]phenyl]benzene-1,2,3,4,5-pentol;bis(prop-1-ene) (PubChem CID 145442200) has the molecular formula C59H52N2O9 and a molecular weight of 933.07 g/mol. Its IUPAC name is 6-[4-[N-naphthalen-1-yl-4-[4-(N-[4-(2,3,5,6-tetrahydroxy-4-methylphenyl)phenyl]anilino)phenyl]anilino]phenyl]benzene-1,2,3,4,5-pentol;bis(prop-1-ene).
| Compound Name | 6-[4-[N-naphthalen-1-yl-4-[4-(N-[4-(2,3,5,6-tetrahydroxy-4-methylphenyl)phenyl]anilino)phenyl]anilino]phenyl]benzene-1,2,3,4,5-pentol;bis(prop-1-ene) |
|---|---|
| PubChem CID | 145442200 |
| Molecular Formula | C59H52N2O9 |
| Molecular Weight | 933.07 g/mol |
| Exact Mass | 932.37 |
| IUPAC Name | 6-[4-[N-naphthalen-1-yl-4-[4-(N-[4-(2,3,5,6-tetrahydroxy-4-methylphenyl)phenyl]anilino)phenyl]anilino]phenyl]benzene-1,2,3,4,5-pentol;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.Cc1c(O)c(O)c(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccc(-c6c(O)c(O)c(O)c(O)c6O)cc5)c5cccc6ccccc56)cc4)cc3)cc2)c(O)c1O |
| InChI | InChI=1S/C53H40N2O9.2C3H6/c1-30-45(56)47(58)43(48(59)46(30)57)34-18-26-38(27-19-34)54(36-10-3-2-4-11-36)37-22-14-31(15-23-37)32-16-24-39(25-17-32)55(42-13-7-9-33-8-5-6-12-41(33)42)40-28-20-35(21-29-40)44-49(60)51(62)53(64)52(63)50(44)61;2*1-3-2/h2-29,56-64H,1H3;2*3H,1H2,2H3 |
| InChIKey | UWEIMCIFBWVHIX-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 188.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.07 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|