C15H24O2 — CID 14544222
(3R,6S,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,9-diol (PubChem CID 14544222) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3R,6S,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,9-diol.
| Compound Name | (3R,6S,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,9-diol |
|---|---|
| PubChem CID | 14544222 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3R,6S,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,9-diol |
| SMILES | CC1=C2CC(C)(C)[C@H](O)[C@H]2C[C@]2(C)CC[C@]12O |
| InChI | InChI=1S/C15H24O2/c1-9-10-7-13(2,3)12(16)11(10)8-14(4)5-6-15(9,14)17/h11-12,16-17H,5-8H2,1-4H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | SDDDDLJOCMWSOQ-NEBZKDRISA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|