C15H24O3 — CID 14544233
(3R,4R,6R,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,4,9-triol (PubChem CID 14544233) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R,4R,6R,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,4,9-triol.
| Compound Name | (3R,4R,6R,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,4,9-triol |
|---|---|
| PubChem CID | 14544233 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R,4R,6R,8S,9R)-2,6,10,10-tetramethyltricyclo[6.3.0.03,6]undec-1-ene-3,4,9-triol |
| SMILES | CC1=C2CC(C)(C)[C@H](O)[C@H]2C[C@]2(C)C[C@@H](O)[C@]12O |
| InChI | InChI=1S/C15H24O3/c1-8-9-5-13(2,3)12(17)10(9)6-14(4)7-11(16)15(8,14)18/h10-12,16-18H,5-7H2,1-4H3/t10-,11+,12+,14+,15+/m0/s1 |
| InChIKey | XLBWTJGHQUFUDJ-PGKPSXLWSA-N |
| XLogP | 1.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|