C21H21NO4 — CID 145442391
3-[4-(3,5-dimethylanilino)phenyl]-6-methylbenzene-1,2,4,5-tetrol (PubChem CID 145442391) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylanilino)phenyl]-6-methylbenzene-1,2,4,5-tetrol.
| Compound Name | 3-[4-(3,5-dimethylanilino)phenyl]-6-methylbenzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 145442391 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-[4-(3,5-dimethylanilino)phenyl]-6-methylbenzene-1,2,4,5-tetrol |
| SMILES | Cc1cc(C)cc(Nc2ccc(-c3c(O)c(O)c(C)c(O)c3O)cc2)c1 |
| InChI | InChI=1S/C21H21NO4/c1-11-8-12(2)10-16(9-11)22-15-6-4-14(5-7-15)17-20(25)18(23)13(3)19(24)21(17)26/h4-10,22-26H,1-3H3 |
| InChIKey | NIGOOSBNWPWWKZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|