C23H21N — CID 145442455
N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]naphthalen-2-amine (PubChem CID 145442455) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]naphthalen-2-amine.
| Compound Name | N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 145442455 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]naphthalen-2-amine |
| SMILES | C=C/C=C(\C=C/C)c1ccc(Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H21N/c1-3-7-18(8-4-2)20-11-14-22(15-12-20)24-23-16-13-19-9-5-6-10-21(19)17-23/h3-17,24H,1H2,2H3/b8-4-,18-7+ |
| InChIKey | YOLFDJLAAGEQMC-YAIWCUSNSA-N |
| XLogP | 6.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|