C18H23Cl2N5S — CID 145442767
1-[5-(2,3-dichlorophenyl)sulfanyl-3-ethyl-6-methylpyrazin-2-yl]piperidine-4,4-diamine (PubChem CID 145442767) has the molecular formula C18H23Cl2N5S and a molecular weight of 412.39 g/mol. Its IUPAC name is 1-[5-(2,3-dichlorophenyl)sulfanyl-3-ethyl-6-methylpyrazin-2-yl]piperidine-4,4-diamine.
| Compound Name | 1-[5-(2,3-dichlorophenyl)sulfanyl-3-ethyl-6-methylpyrazin-2-yl]piperidine-4,4-diamine |
|---|---|
| PubChem CID | 145442767 |
| Molecular Formula | C18H23Cl2N5S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[5-(2,3-dichlorophenyl)sulfanyl-3-ethyl-6-methylpyrazin-2-yl]piperidine-4,4-diamine |
| SMILES | CCc1nc(Sc2cccc(Cl)c2Cl)c(C)nc1N1CCC(N)(N)CC1 |
| InChI | InChI=1S/C18H23Cl2N5S/c1-3-13-16(25-9-7-18(21,22)8-10-25)23-11(2)17(24-13)26-14-6-4-5-12(19)15(14)20/h4-6H,3,7-10,21-22H2,1-2H3 |
| InChIKey | WEFZNTUVVQCYQG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|