C19H19Cl2F3N4S — CID 145442899
8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decane (PubChem CID 145442899) has the molecular formula C19H19Cl2F3N4S and a molecular weight of 463.36 g/mol. Its IUPAC name is 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decane.
| Compound Name | 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 145442899 |
| Molecular Formula | C19H19Cl2F3N4S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decane |
| SMILES | FC(F)(F)c1nc(N2CCC3(CCCC3)CC2)cnc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C19H19Cl2F3N4S/c20-14-12(3-8-25-16(14)21)29-17-15(19(22,23)24)27-13(11-26-17)28-9-6-18(7-10-28)4-1-2-5-18/h3,8,11H,1-2,4-7,9-10H2 |
| InChIKey | ZGUQAJQRSKWEAA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|