About (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate
(3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate (PubChem CID 145443530) has the molecular formula C11H13F2N3O2
and a molecular weight of 257.24 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate.
Molecular Properties
| Compound Name | (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate |
| PubChem CID | 145443530 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate |
| SMILES | Cc1ncc(NC(=O)OC2CCC(F)(F)C2)cn1 |
| InChI | InChI=1S/C11H13F2N3O2/c1-7-14-5-8(6-15-7)16-10(17)18-9-2-3-11(12,13)4-9/h5-6,9H,2-4H2,1H3,(H,16,17) |
| InChIKey | QXZGPVMMXUPFCI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate?
The IUPAC name of (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate (CID 145443530) is (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate.
What is the SMILES notation for (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate?
The canonical SMILES for (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate is Cc1ncc(NC(=O)OC2CCC(F)(F)C2)cn1.
What is the InChIKey of (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate?
The InChIKey is QXZGPVMMXUPFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O2/c1-7-14-5-8(6-15-7)16-10(17)18-9-2-3-11(12,13)4-9/h5-6,9H,2-4H2,1H3,(H,16,17).
What are the key properties of (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate?
(3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate has a molecular weight of 257.24 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclopentyl) N-(2-methylpyrimidin-5-yl)carbamate is sourced from PubChem (CID 145443530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).