About 4-chloro-3-N,6-dimethylpyridine-2,3-diamine
4-chloro-3-N,6-dimethylpyridine-2,3-diamine (PubChem CID 145443788) has the molecular formula C7H10ClN3
and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-3-N,6-dimethylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 4-chloro-3-N,6-dimethylpyridine-2,3-diamine |
| PubChem CID | 145443788 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 4-chloro-3-N,6-dimethylpyridine-2,3-diamine |
| SMILES | CNc1c(Cl)cc(C)nc1N |
| InChI | InChI=1S/C7H10ClN3/c1-4-3-5(8)6(10-2)7(9)11-4/h3,10H,1-2H3,(H2,9,11) |
| InChIKey | NJTFHYJNZBSJMJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-N,6-dimethylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-N,6-dimethylpyridine-2,3-diamine?
The IUPAC name of 4-chloro-3-N,6-dimethylpyridine-2,3-diamine (CID 145443788) is 4-chloro-3-N,6-dimethylpyridine-2,3-diamine.
What is the SMILES notation for 4-chloro-3-N,6-dimethylpyridine-2,3-diamine?
The canonical SMILES for 4-chloro-3-N,6-dimethylpyridine-2,3-diamine is CNc1c(Cl)cc(C)nc1N.
What is the InChIKey of 4-chloro-3-N,6-dimethylpyridine-2,3-diamine?
The InChIKey is NJTFHYJNZBSJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3/c1-4-3-5(8)6(10-2)7(9)11-4/h3,10H,1-2H3,(H2,9,11).
What are the key properties of 4-chloro-3-N,6-dimethylpyridine-2,3-diamine?
4-chloro-3-N,6-dimethylpyridine-2,3-diamine has a molecular weight of 171.63 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-N,6-dimethylpyridine-2,3-diamine is sourced from PubChem (CID 145443788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).