About 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane
2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane (PubChem CID 145443790) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane |
| PubChem CID | 145443790 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane |
| SMILES | CCC.Cc1nc(CCN)c(C)s1 |
| InChI | InChI=1S/C7H12N2S.C3H8/c1-5-7(3-4-8)9-6(2)10-5;1-3-2/h3-4,8H2,1-2H3;3H2,1-2H3 |
| InChIKey | GDDNVSOXUCUQLN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane?
The IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane (CID 145443790) is 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane.
What is the SMILES notation for 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane?
The canonical SMILES for 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane is CCC.Cc1nc(CCN)c(C)s1.
What is the InChIKey of 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane?
The InChIKey is GDDNVSOXUCUQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S.C3H8/c1-5-7(3-4-8)9-6(2)10-5;1-3-2/h3-4,8H2,1-2H3;3H2,1-2H3.
What are the key properties of 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane?
2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane has a molecular weight of 200.35 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-1,3-thiazol-4-yl)ethanamine;propane is sourced from PubChem (CID 145443790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).