C35H41BF3N5O6S — CID 145444081
tert-butyl (3S)-3-[[4-[1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 145444081) has the molecular formula C35H41BF3N5O6S and a molecular weight of 727.62 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145444081 |
| Molecular Formula | C35H41BF3N5O6S |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 727.28 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[1-(benzenesulfonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(-c3cn(S(=O)(=O)c4ccccc4)c4cc(B5OC(C)(C)C(C)(C)O5)ccc34)n2)C1 |
| InChI | InChI=1S/C35H41BF3N5O6S/c1-32(2,3)48-31(45)43-17-11-12-23(20-43)41-30-40-19-27(35(37,38)39)29(42-30)26-21-44(51(46,47)24-13-9-8-10-14-24)28-18-22(15-16-25(26)28)36-49-33(4,5)34(6,7)50-36/h8-10,13-16,18-19,21,23H,11-12,17,20H2,1-7H3,(H,40,41,42)/t23-/m0/s1 |
| InChIKey | FKZCVNSJDVBMKS-QHCPKHFHSA-N |
| XLogP | 6.46 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|