C30H38BrF3N6O3Si — CID 145444247
tert-butyl (3S)-3-[[4-[7-bromo-6-cyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 145444247) has the molecular formula C30H38BrF3N6O3Si and a molecular weight of 695.66 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[7-bromo-6-cyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[7-bromo-6-cyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145444247 |
| Molecular Formula | C30H38BrF3N6O3Si |
| Molecular Weight | 695.66 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[7-bromo-6-cyano-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(-c3cn(COCC[Si](C)(C)C)c4c(Br)c(C#N)ccc34)n2)C1 |
| InChI | InChI=1S/C30H38BrF3N6O3Si/c1-29(2,3)43-28(41)39-11-7-8-20(16-39)37-27-36-15-23(30(32,33)34)25(38-27)22-17-40(18-42-12-13-44(4,5)6)26-21(22)10-9-19(14-35)24(26)31/h9-10,15,17,20H,7-8,11-13,16,18H2,1-6H3,(H,36,37,38)/t20-/m0/s1 |
| InChIKey | XKJSSKHWNXKBHN-FQEVSTJZSA-N |
| XLogP | 7.87 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|