About 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine
5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine (PubChem CID 145444250) has the molecular formula C17H16ClF2N5
and a molecular weight of 363.80 g/mol. Its IUPAC name is 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine |
| PubChem CID | 145444250 |
| Molecular Formula | C17H16ClF2N5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Fc1cc2[nH]cc(-c3nc(N[C@H]4CCCNC4)ncc3Cl)c2cc1F |
| InChI | InChI=1S/C17H16ClF2N5/c18-12-8-23-17(24-9-2-1-3-21-6-9)25-16(12)11-7-22-15-5-14(20)13(19)4-10(11)15/h4-5,7-9,21-22H,1-3,6H2,(H,23,24,25)/t9-/m0/s1 |
| InChIKey | WMWJOZFPAJCSFJ-VIFPVBQESA-N |
| XLogP | 3.72 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine?
The IUPAC name of 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine (CID 145444250) is 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine.
What is the SMILES notation for 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine?
The canonical SMILES for 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine is Fc1cc2[nH]cc(-c3nc(N[C@H]4CCCNC4)ncc3Cl)c2cc1F.
What is the InChIKey of 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine?
The InChIKey is WMWJOZFPAJCSFJ-VIFPVBQESA-N. The full InChI is InChI=1S/C17H16ClF2N5/c18-12-8-23-17(24-9-2-1-3-21-6-9)25-16(12)11-7-22-15-5-14(20)13(19)4-10(11)15/h4-5,7-9,21-22H,1-3,6H2,(H,23,24,25)/t9-/m0/s1.
What are the key properties of 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine?
5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine has a molecular weight of 363.80 g/mol, XLogP of 3.72, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(5,6-difluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 145444250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).